C11H15ClN2OS2 — CID 141063289
3-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylpropyl)-3H-1,2-oxazol-5-amine (PubChem CID 141063289) has the molecular formula C11H15ClN2OS2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylpropyl)-3H-1,2-oxazol-5-amine.
| Compound Name | 3-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylpropyl)-3H-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 141063289 |
| Molecular Formula | C11H15ClN2OS2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylpropyl)-3H-1,2-oxazol-5-amine |
| SMILES | CSCCCN1OC(N)=CC1c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H15ClN2OS2/c1-16-6-2-5-14-8(7-11(13)15-14)9-3-4-10(12)17-9/h3-4,7-8H,2,5-6,13H2,1H3 |
| InChIKey | DISJXKPNJQVULN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|