C11H13ClN2OS — CID 91001426
3-(5-chlorothiophen-2-yl)-2-cyclobutyl-5H-1,2-oxazol-5-amine (PubChem CID 91001426) has the molecular formula C11H13ClN2OS and a molecular weight of 256.76 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-2-cyclobutyl-5H-1,2-oxazol-5-amine.
| Compound Name | 3-(5-chlorothiophen-2-yl)-2-cyclobutyl-5H-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 91001426 |
| Molecular Formula | C11H13ClN2OS |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-2-cyclobutyl-5H-1,2-oxazol-5-amine |
| SMILES | NC1C=C(c2ccc(Cl)s2)N(C2CCC2)O1 |
| InChI | InChI=1S/C11H13ClN2OS/c12-10-5-4-9(16-10)8-6-11(13)15-14(8)7-2-1-3-7/h4-7,11H,1-3,13H2 |
| InChIKey | TXCSYVFSPLIUCB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |