C27H31NO2 — CID 141063928
N-[1-(3,4-dimethylphenyl)-3-methylbutyl]-3-(phenoxymethyl)benzamide (PubChem CID 141063928) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-3-methylbutyl]-3-(phenoxymethyl)benzamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)-3-methylbutyl]-3-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 141063928 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-3-methylbutyl]-3-(phenoxymethyl)benzamide |
| SMILES | Cc1ccc(C(CC(C)C)NC(=O)c2cccc(COc3ccccc3)c2)cc1C |
| InChI | InChI=1S/C27H31NO2/c1-19(2)15-26(23-14-13-20(3)21(4)16-23)28-27(29)24-10-8-9-22(17-24)18-30-25-11-6-5-7-12-25/h5-14,16-17,19,26H,15,18H2,1-4H3,(H,28,29) |
| InChIKey | ZQODVIYXPSHZBB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |