C26H25ClF3NO2 — CID 141063881
N-[1-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylbutyl]-3-(phenoxymethyl)benzamide (PubChem CID 141063881) has the molecular formula C26H25ClF3NO2 and a molecular weight of 475.94 g/mol. Its IUPAC name is N-[1-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylbutyl]-3-(phenoxymethyl)benzamide.
| Compound Name | N-[1-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylbutyl]-3-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 141063881 |
| Molecular Formula | C26H25ClF3NO2 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[1-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylbutyl]-3-(phenoxymethyl)benzamide |
| SMILES | CC(C)CC(NC(=O)c1cccc(COc2ccccc2)c1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C26H25ClF3NO2/c1-17(2)13-24(22-15-20(26(28,29)30)11-12-23(22)27)31-25(32)19-8-6-7-18(14-19)16-33-21-9-4-3-5-10-21/h3-12,14-15,17,24H,13,16H2,1-2H3,(H,31,32) |
| InChIKey | PMFRFPPVRWATSC-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |