C20H22F3NO2 — CID 52513780
3-(methoxymethyl)-N-[(1R)-1-[3-(trifluoromethyl)phenyl]butyl]benzamide (PubChem CID 52513780) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 3-(methoxymethyl)-N-[(1R)-1-[3-(trifluoromethyl)phenyl]butyl]benzamide.
| Compound Name | 3-(methoxymethyl)-N-[(1R)-1-[3-(trifluoromethyl)phenyl]butyl]benzamide |
|---|---|
| PubChem CID | 52513780 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-(methoxymethyl)-N-[(1R)-1-[3-(trifluoromethyl)phenyl]butyl]benzamide |
| SMILES | CCC[C@@H](NC(=O)c1cccc(COC)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3NO2/c1-3-6-18(15-8-5-10-17(12-15)20(21,22)23)24-19(25)16-9-4-7-14(11-16)13-26-2/h4-5,7-12,18H,3,6,13H2,1-2H3,(H,24,25)/t18-/m1/s1 |
| InChIKey | CJXXPQBADLECSS-GOSISDBHSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |