C21H22F3NO2 — CID 52523148
4-oxo-4-phenyl-N-[(1S)-1-[3-(trifluoromethyl)phenyl]butyl]butanamide (PubChem CID 52523148) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 4-oxo-4-phenyl-N-[(1S)-1-[3-(trifluoromethyl)phenyl]butyl]butanamide.
| Compound Name | 4-oxo-4-phenyl-N-[(1S)-1-[3-(trifluoromethyl)phenyl]butyl]butanamide |
|---|---|
| PubChem CID | 52523148 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-oxo-4-phenyl-N-[(1S)-1-[3-(trifluoromethyl)phenyl]butyl]butanamide |
| SMILES | CCC[C@H](NC(=O)CCC(=O)c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3NO2/c1-2-7-18(16-10-6-11-17(14-16)21(22,23)24)25-20(27)13-12-19(26)15-8-4-3-5-9-15/h3-6,8-11,14,18H,2,7,12-13H2,1H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | XACMKJQNBXBLPJ-SFHVURJKSA-N |
| XLogP | 5.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |