C21H14ClF4NO2 — CID 4134181
3-[(4-chlorophenoxy)methyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 4134181) has the molecular formula C21H14ClF4NO2 and a molecular weight of 423.79 g/mol. Its IUPAC name is 3-[(4-chlorophenoxy)methyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(4-chlorophenoxy)methyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4134181 |
| Molecular Formula | C21H14ClF4NO2 |
| Molecular Weight | 423.79 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-[(4-chlorophenoxy)methyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1F)c1cccc(COc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H14ClF4NO2/c22-16-5-7-17(8-6-16)29-12-13-2-1-3-14(10-13)20(28)27-19-11-15(21(24,25)26)4-9-18(19)23/h1-11H,12H2,(H,27,28) |
| InChIKey | UTGZKICHXCDUJL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.79 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |