C17H17ClN2O2S — CID 141063953
N-(3-chloro-1H-indol-7-yl)-N-(2-phenylethyl)methanesulfonamide (PubChem CID 141063953) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is N-(3-chloro-1H-indol-7-yl)-N-(2-phenylethyl)methanesulfonamide.
| Compound Name | N-(3-chloro-1H-indol-7-yl)-N-(2-phenylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 141063953 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-(3-chloro-1H-indol-7-yl)-N-(2-phenylethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCc1ccccc1)c1cccc2c(Cl)c[nH]c12 |
| InChI | InChI=1S/C17H17ClN2O2S/c1-23(21,22)20(11-10-13-6-3-2-4-7-13)16-9-5-8-14-15(18)12-19-17(14)16/h2-9,12,19H,10-11H2,1H3 |
| InChIKey | NPXQVVABTMVKPG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |