C13H9F4NO4 — CID 141065908
ethyl 8-(difluoromethoxy)-1,2-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 141065908) has the molecular formula C13H9F4NO4 and a molecular weight of 319.21 g/mol. Its IUPAC name is ethyl 8-(difluoromethoxy)-1,2-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 8-(difluoromethoxy)-1,2-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 141065908 |
| Molecular Formula | C13H9F4NO4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | ethyl 8-(difluoromethoxy)-1,2-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(F)n(F)c2c(OC(F)F)cccc2c1=O |
| InChI | InChI=1S/C13H9F4NO4/c1-2-21-12(20)8-10(19)6-4-3-5-7(22-13(15)16)9(6)18(17)11(8)14/h3-5,13H,2H2,1H3 |
| InChIKey | NSMZVLZALMEWKW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|