C12H8ClF2NO3 — CID 141380803
ethyl 8-chloro-1,2-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 141380803) has the molecular formula C12H8ClF2NO3 and a molecular weight of 287.65 g/mol. Its IUPAC name is ethyl 8-chloro-1,2-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 8-chloro-1,2-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 141380803 |
| Molecular Formula | C12H8ClF2NO3 |
| Molecular Weight | 287.65 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | ethyl 8-chloro-1,2-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(F)n(F)c2c(Cl)cccc2c1=O |
| InChI | InChI=1S/C12H8ClF2NO3/c1-2-19-12(18)8-10(17)6-4-3-5-7(13)9(6)16(15)11(8)14/h3-5H,2H2,1H3 |
| InChIKey | LRQUIXJMUNPINJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.65 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|