C16H18O — CID 141066393
(E)-5-[4-[(E)-pent-3-enyl]phenyl]pent-2-en-4-yn-1-ol (PubChem CID 141066393) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is (E)-5-[4-[(E)-pent-3-enyl]phenyl]pent-2-en-4-yn-1-ol.
| Compound Name | (E)-5-[4-[(E)-pent-3-enyl]phenyl]pent-2-en-4-yn-1-ol |
|---|---|
| PubChem CID | 141066393 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (E)-5-[4-[(E)-pent-3-enyl]phenyl]pent-2-en-4-yn-1-ol |
| SMILES | C/C=C/CCc1ccc(C#C/C=C/CO)cc1 |
| InChI | InChI=1S/C16H18O/c1-2-3-5-8-15-10-12-16(13-11-15)9-6-4-7-14-17/h2-4,7,10-13,17H,5,8,14H2,1H3/b3-2+,7-4+ |
| InChIKey | KTSQHLROKCKSNI-AOGGBPEJSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|