C17H21F6NO4S — CID 141068066
N-(cyclohexylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 141068066) has the molecular formula C17H21F6NO4S and a molecular weight of 449.41 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | N-(cyclohexylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 141068066 |
| Molecular Formula | C17H21F6NO4S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-(cyclohexylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCCC1)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C17H21F6NO4S/c18-16(19,20)10-27-13-6-7-14(28-11-17(21,22)23)15(8-13)29(25,26)24-9-12-4-2-1-3-5-12/h6-8,12,24H,1-5,9-11H2 |
| InChIKey | OFANMYXTMMKSFS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |