C21H24F6NO7PS — CID 3870578
N-[4-(diethoxyphosphorylmethyl)phenyl]-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 3870578) has the molecular formula C21H24F6NO7PS and a molecular weight of 579.45 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3870578 |
| Molecular Formula | C21H24F6NO7PS |
| Molecular Weight | 579.45 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | CCOP(=O)(Cc1ccc(NS(=O)(=O)c2cc(OCC(F)(F)F)ccc2OCC(F)(F)F)cc1)OCC |
| InChI | InChI=1S/C21H24F6NO7PS/c1-3-34-36(29,35-4-2)12-15-5-7-16(8-6-15)28-37(30,31)19-11-17(32-13-20(22,23)24)9-10-18(19)33-14-21(25,26)27/h5-11,28H,3-4,12-14H2,1-2H3 |
| InChIKey | UCVWBWNSVSBWAY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|