C19H21F6N2O6PS — CID 59649312
N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide (PubChem CID 59649312) has the molecular formula C19H21F6N2O6PS and a molecular weight of 550.41 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 59649312 |
| Molecular Formula | C19H21F6N2O6PS |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CCOP(=O)(Cc1csc(NC(=O)c2cc(OCC(F)(F)F)ccc2OCC(F)(F)F)n1)OCC |
| InChI | InChI=1S/C19H21F6N2O6PS/c1-3-32-34(29,33-4-2)8-12-9-35-17(26-12)27-16(28)14-7-13(30-10-18(20,21)22)5-6-15(14)31-11-19(23,24)25/h5-7,9H,3-4,8,10-11H2,1-2H3,(H,26,27,28) |
| InChIKey | GCQGBGIHSGDBOM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|