C9H19N2O3PS — CID 159390747
4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-amine;methane (PubChem CID 159390747) has the molecular formula C9H19N2O3PS and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-amine;methane.
| Compound Name | 4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-amine;methane |
|---|---|
| PubChem CID | 159390747 |
| Molecular Formula | C9H19N2O3PS |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-amine;methane |
| SMILES | C.CCOP(=O)(Cc1csc(N)n1)OCC |
| InChI | InChI=1S/C8H15N2O3PS.CH4/c1-3-12-14(11,13-4-2)5-7-6-15-8(9)10-7;/h6H,3-5H2,1-2H3,(H2,9,10);1H4 |
| InChIKey | LMBRLIDQDVCHGJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|