C15H20NO3PS — CID 166282816
2-(diethoxyphosphorylmethyl)-4-(4-methylphenyl)-1,3-thiazole (PubChem CID 166282816) has the molecular formula C15H20NO3PS and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-(diethoxyphosphorylmethyl)-4-(4-methylphenyl)-1,3-thiazole.
| Compound Name | 2-(diethoxyphosphorylmethyl)-4-(4-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 166282816 |
| Molecular Formula | C15H20NO3PS |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-(diethoxyphosphorylmethyl)-4-(4-methylphenyl)-1,3-thiazole |
| SMILES | CCOP(=O)(Cc1nc(-c2ccc(C)cc2)cs1)OCC |
| InChI | InChI=1S/C15H20NO3PS/c1-4-18-20(17,19-5-2)10-15-16-14(11-21-15)13-8-6-12(3)7-9-13/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | LRDSROLZDNRIIF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|