C14H24NO3PS — CID 154793219
2-cyclohexyl-4-(diethoxyphosphorylmethyl)-1,3-thiazole (PubChem CID 154793219) has the molecular formula C14H24NO3PS and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-cyclohexyl-4-(diethoxyphosphorylmethyl)-1,3-thiazole.
| Compound Name | 2-cyclohexyl-4-(diethoxyphosphorylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 154793219 |
| Molecular Formula | C14H24NO3PS |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-cyclohexyl-4-(diethoxyphosphorylmethyl)-1,3-thiazole |
| SMILES | CCOP(=O)(Cc1csc(C2CCCCC2)n1)OCC |
| InChI | InChI=1S/C14H24NO3PS/c1-3-17-19(16,18-4-2)10-13-11-20-14(15-13)12-8-6-5-7-9-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | NNQLNXIIVTUNCG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|