C8H14NO2PS — CID 58266067
4-[[ethoxy(methyl)phosphoryl]methyl]-2-methyl-1,3-thiazole (PubChem CID 58266067) has the molecular formula C8H14NO2PS and a molecular weight of 219.25 g/mol. Its IUPAC name is 4-[[ethoxy(methyl)phosphoryl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[ethoxy(methyl)phosphoryl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 58266067 |
| Molecular Formula | C8H14NO2PS |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 4-[[ethoxy(methyl)phosphoryl]methyl]-2-methyl-1,3-thiazole |
| SMILES | CCO[P@@](C)(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C8H14NO2PS/c1-4-11-12(3,10)5-8-6-13-7(2)9-8/h6H,4-5H2,1-3H3/t12-/m1/s1 |
| InChIKey | DTBWPIROGZXQRC-GFCCVEGCSA-N |
| XLogP | 2.90 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|