C22H33N2O6PS — CID 58266211
N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-2-[2,4-di(propan-2-yloxy)phenyl]acetamide (PubChem CID 58266211) has the molecular formula C22H33N2O6PS and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-2-[2,4-di(propan-2-yloxy)phenyl]acetamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-2-[2,4-di(propan-2-yloxy)phenyl]acetamide |
|---|---|
| PubChem CID | 58266211 |
| Molecular Formula | C22H33N2O6PS |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-2-[2,4-di(propan-2-yloxy)phenyl]acetamide |
| SMILES | CCOP(=O)(Cc1csc(NC(=O)Cc2ccc(OC(C)C)cc2OC(C)C)n1)OCC |
| InChI | InChI=1S/C22H33N2O6PS/c1-7-27-31(26,28-8-2)13-18-14-32-22(23-18)24-21(25)11-17-9-10-19(29-15(3)4)12-20(17)30-16(5)6/h9-10,12,14-16H,7-8,11,13H2,1-6H3,(H,23,24,25) |
| InChIKey | CMCXKZUMRZNGJT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|