C17H24N2 — CID 141068569
1-(1-benzylpiperidin-4-yl)-3,6-dihydro-2H-pyridine (PubChem CID 141068569) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 141068569 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3,6-dihydro-2H-pyridine |
| SMILES | C1=CCN(C2CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C17H24N2/c1-3-7-16(8-4-1)15-18-13-9-17(10-14-18)19-11-5-2-6-12-19/h1-5,7-8,17H,6,9-15H2 |
| InChIKey | NLBVGOHRLRLDFQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|