C17H11ClI2N2O2S — CID 141068869
5-(5-chlorothiophen-2-yl)-3-[(3,7-diiodo-4-methoxyindol-1-yl)methyl]-1,2-oxazole (PubChem CID 141068869) has the molecular formula C17H11ClI2N2O2S and a molecular weight of 596.62 g/mol. Its IUPAC name is 5-(5-chlorothiophen-2-yl)-3-[(3,7-diiodo-4-methoxyindol-1-yl)methyl]-1,2-oxazole.
| Compound Name | 5-(5-chlorothiophen-2-yl)-3-[(3,7-diiodo-4-methoxyindol-1-yl)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 141068869 |
| Molecular Formula | C17H11ClI2N2O2S |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 595.83 |
| IUPAC Name | 5-(5-chlorothiophen-2-yl)-3-[(3,7-diiodo-4-methoxyindol-1-yl)methyl]-1,2-oxazole |
| SMILES | COc1ccc(I)c2c1c(I)cn2Cc1cc(-c2ccc(Cl)s2)on1 |
| InChI | InChI=1S/C17H11ClI2N2O2S/c1-23-12-3-2-10(19)17-16(12)11(20)8-22(17)7-9-6-13(24-21-9)14-4-5-15(18)25-14/h2-6,8H,7H2,1H3 |
| InChIKey | DIAUXHHBTYLRTJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|