C19H17N3O3 — CID 141070020
4-[(2,3-dimethyl-1H-indol-5-yl)oxy]-6-methoxy-1H-quinazolin-2-one (PubChem CID 141070020) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-[(2,3-dimethyl-1H-indol-5-yl)oxy]-6-methoxy-1H-quinazolin-2-one.
| Compound Name | 4-[(2,3-dimethyl-1H-indol-5-yl)oxy]-6-methoxy-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 141070020 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-[(2,3-dimethyl-1H-indol-5-yl)oxy]-6-methoxy-1H-quinazolin-2-one |
| SMILES | COc1ccc2[nH]c(=O)nc(Oc3ccc4[nH]c(C)c(C)c4c3)c2c1 |
| InChI | InChI=1S/C19H17N3O3/c1-10-11(2)20-16-7-5-13(9-14(10)16)25-18-15-8-12(24-3)4-6-17(15)21-19(23)22-18/h4-9,20H,1-3H3,(H,21,22,23) |
| InChIKey | UYGKAMUOOXUXBL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|