C7H14O4 — CID 141071635
1,3,5-trihydroxy-4-methylhexan-2-one (PubChem CID 141071635) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is 1,3,5-trihydroxy-4-methylhexan-2-one.
| Compound Name | 1,3,5-trihydroxy-4-methylhexan-2-one |
|---|---|
| PubChem CID | 141071635 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1,3,5-trihydroxy-4-methylhexan-2-one |
| SMILES | CC(O)C(C)C(O)C(=O)CO |
| InChI | InChI=1S/C7H14O4/c1-4(5(2)9)7(11)6(10)3-8/h4-5,7-9,11H,3H2,1-2H3 |
| InChIKey | SAQZNCQLCBRERF-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |