C21H30N4O — CID 141072356
N,N-diethyl-4-[[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]amino]benzamide (PubChem CID 141072356) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is N,N-diethyl-4-[[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 141072356 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N,N-diethyl-4-[[1-(1H-pyrrol-2-ylmethyl)piperidin-4-yl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC2CCN(Cc3ccc[nH]3)CC2)cc1 |
| InChI | InChI=1S/C21H30N4O/c1-3-25(4-2)21(26)17-7-9-18(10-8-17)23-19-11-14-24(15-12-19)16-20-6-5-13-22-20/h5-10,13,19,22-23H,3-4,11-12,14-16H2,1-2H3 |
| InChIKey | QHMLBNNEZOZFSL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |