About 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene
2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene (PubChem CID 141073909) has the molecular formula C21H21BrO2S
and a molecular weight of 417.37 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene.
Molecular Properties
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene |
| PubChem CID | 141073909 |
| Molecular Formula | C21H21BrO2S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene |
| SMILES | CCOc1ccc(-c2sc(-c3ccc(OC)c(Br)c3)c(C)c2C)cc1 |
| InChI | InChI=1S/C21H21BrO2S/c1-5-24-17-9-6-15(7-10-17)20-13(2)14(3)21(25-20)16-8-11-19(23-4)18(22)12-16/h6-12H,5H2,1-4H3 |
| InChIKey | GCAFDJMFRHWSRJ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene?
The IUPAC name of 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene (CID 141073909) is 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene.
What is the SMILES notation for 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene?
The canonical SMILES for 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene is CCOc1ccc(-c2sc(-c3ccc(OC)c(Br)c3)c(C)c2C)cc1.
What is the InChIKey of 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene?
The InChIKey is GCAFDJMFRHWSRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21BrO2S/c1-5-24-17-9-6-15(7-10-17)20-13(2)14(3)21(25-20)16-8-11-19(23-4)18(22)12-16/h6-12H,5H2,1-4H3.
What are the key properties of 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene?
2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene has a molecular weight of 417.37 g/mol, XLogP of 6.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-4-methoxyphenyl)-5-(4-ethoxyphenyl)-3,4-dimethylthiophene is sourced from PubChem (CID 141073909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).