C24H28F3NO — CID 141074608
2-[4-(3-ethyl-2-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentyl]-1H-indole (PubChem CID 141074608) has the molecular formula C24H28F3NO and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-[4-(3-ethyl-2-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentyl]-1H-indole.
| Compound Name | 2-[4-(3-ethyl-2-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentyl]-1H-indole |
|---|---|
| PubChem CID | 141074608 |
| Molecular Formula | C24H28F3NO |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-[4-(3-ethyl-2-methoxyphenyl)-4-methyl-2-(trifluoromethyl)pentyl]-1H-indole |
| SMILES | CCc1cccc(C(C)(C)CC(Cc2cc3ccccc3[nH]2)C(F)(F)F)c1OC |
| InChI | InChI=1S/C24H28F3NO/c1-5-16-10-8-11-20(22(16)29-4)23(2,3)15-18(24(25,26)27)14-19-13-17-9-6-7-12-21(17)28-19/h6-13,18,28H,5,14-15H2,1-4H3 |
| InChIKey | NOBRIUSMRMVMBF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |