C24H44O6Si — CID 141075975
(E)-3-(4-oxo-4-tributylsilyloxybutoxy)carbonylhept-2-enoic acid (PubChem CID 141075975) has the molecular formula C24H44O6Si and a molecular weight of 456.70 g/mol. Its IUPAC name is (E)-3-(4-oxo-4-tributylsilyloxybutoxy)carbonylhept-2-enoic acid.
| Compound Name | (E)-3-(4-oxo-4-tributylsilyloxybutoxy)carbonylhept-2-enoic acid |
|---|---|
| PubChem CID | 141075975 |
| Molecular Formula | C24H44O6Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (E)-3-(4-oxo-4-tributylsilyloxybutoxy)carbonylhept-2-enoic acid |
| SMILES | CCCC/C(=C\C(=O)O)C(=O)OCCCC(=O)O[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C24H44O6Si/c1-5-9-14-21(20-22(25)26)24(28)29-16-13-15-23(27)30-31(17-10-6-2,18-11-7-3)19-12-8-4/h20H,5-19H2,1-4H3,(H,25,26)/b21-20+ |
| InChIKey | FJQTXFQNCIDVKH-QZQOTICOSA-N |
| XLogP | 6.40 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|