C12H23NO6S — CID 141076378
tert-butyl 4-(hydroxymethyl)-2-methylsulfonyloxypiperidine-1-carboxylate (PubChem CID 141076378) has the molecular formula C12H23NO6S and a molecular weight of 309.38 g/mol. Its IUPAC name is tert-butyl 4-(hydroxymethyl)-2-methylsulfonyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(hydroxymethyl)-2-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 141076378 |
| Molecular Formula | C12H23NO6S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | tert-butyl 4-(hydroxymethyl)-2-methylsulfonyloxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CO)CC1OS(C)(=O)=O |
| InChI | InChI=1S/C12H23NO6S/c1-12(2,3)18-11(15)13-6-5-9(8-14)7-10(13)19-20(4,16)17/h9-10,14H,5-8H2,1-4H3 |
| InChIKey | XZEQYNJYHIWKEY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|