C12H22FNO5S — CID 95479899
tert-butyl (3R,4R)-3-fluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate (PubChem CID 95479899) has the molecular formula C12H22FNO5S and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-fluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-fluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 95479899 |
| Molecular Formula | C12H22FNO5S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | tert-butyl (3R,4R)-3-fluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](COS(C)(=O)=O)[C@@H](F)C1 |
| InChI | InChI=1S/C12H22FNO5S/c1-12(2,3)19-11(15)14-6-5-9(10(13)7-14)8-18-20(4,16)17/h9-10H,5-8H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | DVADQFSVWWQVQN-ZJUUUORDSA-N |
| XLogP | 1.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|