About Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate
Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 119031496) has the molecular formula C11H19ClFNO4S
and a molecular weight of 315.79 g/mol. Its IUPAC name is tert-butyl 4-(chlorosulfonylmethyl)-4-fluoropiperidine-1-carboxylate.
Molecular Properties
| Compound Name | Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate |
| PubChem CID | 119031496 |
| Molecular Formula | C11H19ClFNO4S |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | tert-butyl 4-(chlorosulfonylmethyl)-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CS(=O)(=O)Cl)F |
| InChI | InChI=1S/C11H19ClFNO4S/c1-10(2,3)18-9(15)14-6-4-11(13,5-7-14)8-19(12,16)17/h4-8H2,1-3H3 |
| InChIKey | NXHGNDFJWFCSPS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 433 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate?
The IUPAC name of Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate (CID 119031496) is tert-butyl 4-(chlorosulfonylmethyl)-4-fluoropiperidine-1-carboxylate.
What is the SMILES notation for Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate?
The canonical SMILES for Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(CC1)(CS(=O)(=O)Cl)F.
What is the InChIKey of Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate?
The InChIKey is NXHGNDFJWFCSPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClFNO4S/c1-10(2,3)18-9(15)14-6-4-11(13,5-7-14)8-19(12,16)17/h4-8H2,1-3H3.
What are the key properties of Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate?
Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate has a molecular weight of 315.79 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 4-[(chlorosulfonyl)methyl]-4-fluoropiperidine-1-carboxylate is sourced from PubChem (CID 119031496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).