C10H18NNaO4S — CID 155819765
sodium (3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-sulfinate (PubChem CID 155819765) has the molecular formula C10H18NNaO4S and a molecular weight of 271.31 g/mol. Its IUPAC name is sodium (3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-sulfinate.
| Compound Name | sodium (3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-sulfinate |
|---|---|
| PubChem CID | 155819765 |
| Molecular Formula | C10H18NNaO4S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | sodium (3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-sulfinate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](S(=O)[O-])C1.[Na+] |
| InChI | InChI=1S/C10H19NO4S.Na/c1-10(2,3)15-9(12)11-6-4-5-8(7-11)16(13)14;/h8H,4-7H2,1-3H3,(H,13,14);/q;+1/p-1/t8-;/m1./s1 |
| InChIKey | UEBOYVLZCSVHQB-DDWIOCJRSA-M |
| XLogP | -1.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|