About Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate
Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate (PubChem CID 72212376) has the molecular formula C11H20ClNO4S
and a molecular weight of 297.80 g/mol. Its IUPAC name is tert-butyl 4-(chlorosulfonylmethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate |
| PubChem CID | 72212376 |
| Molecular Formula | C11H20ClNO4S |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | tert-butyl 4-(chlorosulfonylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CS(=O)(=O)Cl |
| InChI | InChI=1S/C11H20ClNO4S/c1-11(2,3)17-10(14)13-6-4-9(5-7-13)8-18(12,15)16/h9H,4-8H2,1-3H3 |
| InChIKey | AYOXDBOOFYZYJD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 388 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate?
The IUPAC name of Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate (CID 72212376) is tert-butyl 4-(chlorosulfonylmethyl)piperidine-1-carboxylate.
What is the SMILES notation for Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate?
The canonical SMILES for Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(CC1)CS(=O)(=O)Cl.
What is the InChIKey of Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate?
The InChIKey is AYOXDBOOFYZYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20ClNO4S/c1-11(2,3)17-10(14)13-6-4-9(5-7-13)8-18(12,15)16/h9H,4-8H2,1-3H3.
What are the key properties of Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate?
Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate has a molecular weight of 297.80 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 4-[(chlorosulfonyl)methyl]piperidine-1-carboxylate is sourced from PubChem (CID 72212376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).