C5H8OS2 — CID 141076800
3,4-dihydropyran-2,2-dithiol (PubChem CID 141076800) has the molecular formula C5H8OS2 and a molecular weight of 148.25 g/mol. Its IUPAC name is 3,4-dihydropyran-2,2-dithiol.
| Compound Name | 3,4-dihydropyran-2,2-dithiol |
|---|---|
| PubChem CID | 141076800 |
| Molecular Formula | C5H8OS2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | 3,4-dihydropyran-2,2-dithiol |
| SMILES | SC1(S)CCC=CO1 |
| InChI | InChI=1S/C5H8OS2/c7-5(8)3-1-2-4-6-5/h2,4,7-8H,1,3H2 |
| InChIKey | RPTHQZSNYQGNGS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|