C25H34N4O2 — CID 141076818
5-(4-methoxypiperidin-1-yl)-N-[3-(5,6,7,8-tetrahydrophthalazin-1-yl)phenyl]pentanamide (PubChem CID 141076818) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5-(4-methoxypiperidin-1-yl)-N-[3-(5,6,7,8-tetrahydrophthalazin-1-yl)phenyl]pentanamide.
| Compound Name | 5-(4-methoxypiperidin-1-yl)-N-[3-(5,6,7,8-tetrahydrophthalazin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 141076818 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 5-(4-methoxypiperidin-1-yl)-N-[3-(5,6,7,8-tetrahydrophthalazin-1-yl)phenyl]pentanamide |
| SMILES | COC1CCN(CCCCC(=O)Nc2cccc(-c3nncc4c3CCCC4)c2)CC1 |
| InChI | InChI=1S/C25H34N4O2/c1-31-22-12-15-29(16-13-22)14-5-4-11-24(30)27-21-9-6-8-19(17-21)25-23-10-3-2-7-20(23)18-26-28-25/h6,8-9,17-18,22H,2-5,7,10-16H2,1H3,(H,27,30) |
| InChIKey | LKHMHVWLENJFRD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|