C12H18FN3OS2 — CID 141078119
(5R)-5-[(2-fluoroethylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one (PubChem CID 141078119) has the molecular formula C12H18FN3OS2 and a molecular weight of 303.43 g/mol. Its IUPAC name is (5R)-5-[(2-fluoroethylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(2-fluoroethylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141078119 |
| Molecular Formula | C12H18FN3OS2 |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (5R)-5-[(2-fluoroethylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CNCCF)N1CCSc1nccs1 |
| InChI | InChI=1S/C12H18FN3OS2/c13-3-4-14-9-10-1-2-11(17)16(10)6-8-19-12-15-5-7-18-12/h5,7,10,14H,1-4,6,8-9H2/t10-/m1/s1 |
| InChIKey | FLRXZFJJHNOLPF-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|