C17H27N3OS2 — CID 141078152
(5R)-5-[(cyclohexylmethylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one (PubChem CID 141078152) has the molecular formula C17H27N3OS2 and a molecular weight of 353.56 g/mol. Its IUPAC name is (5R)-5-[(cyclohexylmethylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(cyclohexylmethylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141078152 |
| Molecular Formula | C17H27N3OS2 |
| Molecular Weight | 353.56 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (5R)-5-[(cyclohexylmethylamino)methyl]-1-[2-(1,3-thiazol-2-ylsulfanyl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CNCC2CCCCC2)N1CCSc1nccs1 |
| InChI | InChI=1S/C17H27N3OS2/c21-16-7-6-15(13-18-12-14-4-2-1-3-5-14)20(16)9-11-23-17-19-8-10-22-17/h8,10,14-15,18H,1-7,9,11-13H2/t15-/m1/s1 |
| InChIKey | ZDNUXQLDIAHNMD-OAHLLOKOSA-N |
| XLogP | 3.40 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|