C16H31NO7 — CID 141078521
hexyl (3R,4R,5S,6R)-3-[ethyl(methyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate (PubChem CID 141078521) has the molecular formula C16H31NO7 and a molecular weight of 349.42 g/mol. Its IUPAC name is hexyl (3R,4R,5S,6R)-3-[ethyl(methyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate.
| Compound Name | hexyl (3R,4R,5S,6R)-3-[ethyl(methyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 141078521 |
| Molecular Formula | C16H31NO7 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | hexyl (3R,4R,5S,6R)-3-[ethyl(methyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
| SMILES | CCCCCCOC(=O)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N(C)CC |
| InChI | InChI=1S/C16H31NO7/c1-4-6-7-8-9-23-15(21)16(22)14(17(3)5-2)13(20)12(19)11(10-18)24-16/h11-14,18-20,22H,4-10H2,1-3H3/t11-,12-,13+,14-,16?/m1/s1 |
| InChIKey | OLYITFMYRMOZFJ-PABDXQCTSA-N |
| XLogP | -0.77 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|