C17H12N2OS — CID 141079827
5-[2-(furan-2-yl)-4-phenylthiophen-3-yl]-1H-pyrazole (PubChem CID 141079827) has the molecular formula C17H12N2OS and a molecular weight of 292.36 g/mol. Its IUPAC name is 5-[2-(furan-2-yl)-4-phenylthiophen-3-yl]-1H-pyrazole.
| Compound Name | 5-[2-(furan-2-yl)-4-phenylthiophen-3-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 141079827 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-[2-(furan-2-yl)-4-phenylthiophen-3-yl]-1H-pyrazole |
| SMILES | c1ccc(-c2csc(-c3ccco3)c2-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C17H12N2OS/c1-2-5-12(6-3-1)13-11-21-17(15-7-4-10-20-15)16(13)14-8-9-18-19-14/h1-11H,(H,18,19) |
| InChIKey | YXZFMKNSSNOIQN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |