C10H16N4O2 — CID 141081196
N-[2-(2-methylpropanoylamino)ethyl]pyrazole-1-carboxamide (PubChem CID 141081196) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[2-(2-methylpropanoylamino)ethyl]pyrazole-1-carboxamide.
| Compound Name | N-[2-(2-methylpropanoylamino)ethyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 141081196 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[2-(2-methylpropanoylamino)ethyl]pyrazole-1-carboxamide |
| SMILES | CC(C)C(=O)NCCNC(=O)n1cccn1 |
| InChI | InChI=1S/C10H16N4O2/c1-8(2)9(15)11-5-6-12-10(16)14-7-3-4-13-14/h3-4,7-8H,5-6H2,1-2H3,(H,11,15)(H,12,16) |
| InChIKey | JTXHESDHPNSFLC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|