C8H6N4 — CID 141083595
5-pyridin-3-yl-1,2,4-triazine (PubChem CID 141083595) has the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. Its IUPAC name is 5-pyridin-3-yl-1,2,4-triazine.
| Compound Name | 5-pyridin-3-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 141083595 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 5-pyridin-3-yl-1,2,4-triazine |
| SMILES | c1cncc(-c2cnncn2)c1 |
| InChI | InChI=1S/C8H6N4/c1-2-7(4-9-3-1)8-5-11-12-6-10-8/h1-6H |
| InChIKey | LYXSIVBJMKGXCW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |