C9H11N3O2S2 — CID 141083646
5-[2-(1-methylimidazol-2-yl)sulfonylethyl]-1,3-thiazole (PubChem CID 141083646) has the molecular formula C9H11N3O2S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 5-[2-(1-methylimidazol-2-yl)sulfonylethyl]-1,3-thiazole.
| Compound Name | 5-[2-(1-methylimidazol-2-yl)sulfonylethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 141083646 |
| Molecular Formula | C9H11N3O2S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 5-[2-(1-methylimidazol-2-yl)sulfonylethyl]-1,3-thiazole |
| SMILES | Cn1ccnc1S(=O)(=O)CCc1cncs1 |
| InChI | InChI=1S/C9H11N3O2S2/c1-12-4-3-11-9(12)16(13,14)5-2-8-6-10-7-15-8/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | HLSJZOZFTYVBJG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |