C18H24Br2Si3 — CID 141084785
(3,7-dibromo-5-trimethylsilylbenzo[b][1]benzosilol-5-yl)-trimethylsilane (PubChem CID 141084785) has the molecular formula C18H24Br2Si3 and a molecular weight of 484.46 g/mol. Its IUPAC name is (3,7-dibromo-5-trimethylsilylbenzo[b][1]benzosilol-5-yl)-trimethylsilane.
| Compound Name | (3,7-dibromo-5-trimethylsilylbenzo[b][1]benzosilol-5-yl)-trimethylsilane |
|---|---|
| PubChem CID | 141084785 |
| Molecular Formula | C18H24Br2Si3 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 481.96 |
| IUPAC Name | (3,7-dibromo-5-trimethylsilylbenzo[b][1]benzosilol-5-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)[Si]1([Si](C)(C)C)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C18H24Br2Si3/c1-21(2,3)23(22(4,5)6)17-11-13(19)7-9-15(17)16-10-8-14(20)12-18(16)23/h7-12H,1-6H3 |
| InChIKey | DKIMODHLDRJGRI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|