C36H30Cl2O2 — CID 141085805
1-[3,3-bis[4-(4-chlorophenyl)phenyl]-2-ethoxyprop-2-enoxy]-3-methylbenzene (PubChem CID 141085805) has the molecular formula C36H30Cl2O2 and a molecular weight of 565.54 g/mol. Its IUPAC name is 1-[3,3-bis[4-(4-chlorophenyl)phenyl]-2-ethoxyprop-2-enoxy]-3-methylbenzene.
| Compound Name | 1-[3,3-bis[4-(4-chlorophenyl)phenyl]-2-ethoxyprop-2-enoxy]-3-methylbenzene |
|---|---|
| PubChem CID | 141085805 |
| Molecular Formula | C36H30Cl2O2 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 1-[3,3-bis[4-(4-chlorophenyl)phenyl]-2-ethoxyprop-2-enoxy]-3-methylbenzene |
| SMILES | CCOC(COc1cccc(C)c1)=C(c1ccc(-c2ccc(Cl)cc2)cc1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C36H30Cl2O2/c1-3-39-35(24-40-34-6-4-5-25(2)23-34)36(30-11-7-26(8-12-30)28-15-19-32(37)20-16-28)31-13-9-27(10-14-31)29-17-21-33(38)22-18-29/h4-23H,3,24H2,1-2H3 |
| InChIKey | UXFPSUWJLBYEMF-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|