C34H26Cl2N2O4 — CID 141086818
1-(2,6-dichlorophenyl)-2-(4-methylphenyl)-3-nitro-5-(2-nitrophenyl)-4-(4-propan-2-ylphenyl)benzene (PubChem CID 141086818) has the molecular formula C34H26Cl2N2O4 and a molecular weight of 597.50 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2-(4-methylphenyl)-3-nitro-5-(2-nitrophenyl)-4-(4-propan-2-ylphenyl)benzene.
| Compound Name | 1-(2,6-dichlorophenyl)-2-(4-methylphenyl)-3-nitro-5-(2-nitrophenyl)-4-(4-propan-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 141086818 |
| Molecular Formula | C34H26Cl2N2O4 |
| Molecular Weight | 597.50 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2-(4-methylphenyl)-3-nitro-5-(2-nitrophenyl)-4-(4-propan-2-ylphenyl)benzene |
| SMILES | Cc1ccc(-c2c(-c3c(Cl)cccc3Cl)cc(-c3ccccc3[N+](=O)[O-])c(-c3ccc(C(C)C)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H26Cl2N2O4/c1-20(2)22-15-17-24(18-16-22)31-26(25-7-4-5-10-30(25)37(39)40)19-27(33-28(35)8-6-9-29(33)36)32(34(31)38(41)42)23-13-11-21(3)12-14-23/h4-20H,1-3H3 |
| InChIKey | ARFDFKZWMCDHKF-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.50 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|