C13H18O3 — CID 141087145
2-methylpentan-2-yl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate (PubChem CID 141087145) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-methylpentan-2-yl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate.
| Compound Name | 2-methylpentan-2-yl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 141087145 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-methylpentan-2-yl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
| SMILES | CCCC(C)(C)OC(=O)C12C=CC=CC1O2 |
| InChI | InChI=1S/C13H18O3/c1-4-8-12(2,3)16-11(14)13-9-6-5-7-10(13)15-13/h5-7,9-10H,4,8H2,1-3H3 |
| InChIKey | VQMOMDQRMGMQQS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|