C10H7N5O2 — CID 141088251
4,7-diamino-6-nitroquinoline-3-carbonitrile (PubChem CID 141088251) has the molecular formula C10H7N5O2 and a molecular weight of 229.20 g/mol. Its IUPAC name is 4,7-diamino-6-nitroquinoline-3-carbonitrile.
| Compound Name | 4,7-diamino-6-nitroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 141088251 |
| Molecular Formula | C10H7N5O2 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 4,7-diamino-6-nitroquinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(N)c([N+](=O)[O-])cc2c1N |
| InChI | InChI=1S/C10H7N5O2/c11-3-5-4-14-8-2-7(12)9(15(16)17)1-6(8)10(5)13/h1-2,4H,12H2,(H2,13,14) |
| InChIKey | VZTMKDFRCSFVOT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|