C16H17F2NO2S — CID 141088267
N-[(2,4-difluorophenyl)methyl]-N-(2-methylsulfonylethyl)aniline (PubChem CID 141088267) has the molecular formula C16H17F2NO2S and a molecular weight of 325.38 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-N-(2-methylsulfonylethyl)aniline.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-N-(2-methylsulfonylethyl)aniline |
|---|---|
| PubChem CID | 141088267 |
| Molecular Formula | C16H17F2NO2S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-N-(2-methylsulfonylethyl)aniline |
| SMILES | CS(=O)(=O)CCN(Cc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C16H17F2NO2S/c1-22(20,21)10-9-19(15-5-3-2-4-6-15)12-13-7-8-14(17)11-16(13)18/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | QFBILSNCUPFUIA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |