C19H24N2O2 — CID 141088427
4-(azepan-4-ylmethyl)-1-benzyl-3-hydroxypyridin-2-one (PubChem CID 141088427) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 4-(azepan-4-ylmethyl)-1-benzyl-3-hydroxypyridin-2-one.
| Compound Name | 4-(azepan-4-ylmethyl)-1-benzyl-3-hydroxypyridin-2-one |
|---|---|
| PubChem CID | 141088427 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4-(azepan-4-ylmethyl)-1-benzyl-3-hydroxypyridin-2-one |
| SMILES | O=c1c(O)c(CC2CCCNCC2)ccn1Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O2/c22-18-17(13-15-7-4-10-20-11-8-15)9-12-21(19(18)23)14-16-5-2-1-3-6-16/h1-3,5-6,9,12,15,20,22H,4,7-8,10-11,13-14H2 |
| InChIKey | PDCCEBIXYKPJJZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |