About 1-chloroethyl dipentyl phosphate
1-chloroethyl dipentyl phosphate (PubChem CID 141088455) has the molecular formula C12H26ClO4P
and a molecular weight of 300.76 g/mol. Its IUPAC name is 1-chloroethyl dipentyl phosphate.
Molecular Properties
| Compound Name | 1-chloroethyl dipentyl phosphate |
| PubChem CID | 141088455 |
| Molecular Formula | C12H26ClO4P |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-chloroethyl dipentyl phosphate |
| SMILES | CCCCCOP(=O)(OCCCCC)OC(C)Cl |
| InChI | InChI=1S/C12H26ClO4P/c1-4-6-8-10-15-18(14,17-12(3)13)16-11-9-7-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | ZNBCRIXCNAAJJS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl dipentyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl dipentyl phosphate?
The IUPAC name of 1-chloroethyl dipentyl phosphate (CID 141088455) is 1-chloroethyl dipentyl phosphate.
What is the SMILES notation for 1-chloroethyl dipentyl phosphate?
The canonical SMILES for 1-chloroethyl dipentyl phosphate is CCCCCOP(=O)(OCCCCC)OC(C)Cl.
What is the InChIKey of 1-chloroethyl dipentyl phosphate?
The InChIKey is ZNBCRIXCNAAJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26ClO4P/c1-4-6-8-10-15-18(14,17-12(3)13)16-11-9-7-5-2/h12H,4-11H2,1-3H3.
What are the key properties of 1-chloroethyl dipentyl phosphate?
1-chloroethyl dipentyl phosphate has a molecular weight of 300.76 g/mol, XLogP of 5.11, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl dipentyl phosphate is sourced from PubChem (CID 141088455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).