C12H23Cl2O3P — CID 135004805
1-[[(Z)-1,2-dichloroethenyl]-pentoxyphosphoryl]oxypentane (PubChem CID 135004805) has the molecular formula C12H23Cl2O3P and a molecular weight of 317.19 g/mol. Its IUPAC name is 1-[[(Z)-1,2-dichloroethenyl]-pentoxyphosphoryl]oxypentane.
| Compound Name | 1-[[(Z)-1,2-dichloroethenyl]-pentoxyphosphoryl]oxypentane |
|---|---|
| PubChem CID | 135004805 |
| Molecular Formula | C12H23Cl2O3P |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-[[(Z)-1,2-dichloroethenyl]-pentoxyphosphoryl]oxypentane |
| SMILES | CCCCCOP(=O)(OCCCCC)/C(Cl)=C/Cl |
| InChI | InChI=1S/C12H23Cl2O3P/c1-3-5-7-9-16-18(15,12(14)11-13)17-10-8-6-4-2/h11H,3-10H2,1-2H3/b12-11+ |
| InChIKey | TUSPMSBMFJFCCA-VAWYXSNFSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|